C18H21NO4S — CID 57126924
methyl 2-[1,1-diphenylethyl(methyl)sulfamoyl]acetate (PubChem CID 57126924) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is methyl 2-[1,1-diphenylethyl(methyl)sulfamoyl]acetate.
| Compound Name | methyl 2-[1,1-diphenylethyl(methyl)sulfamoyl]acetate |
|---|---|
| PubChem CID | 57126924 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | methyl 2-[1,1-diphenylethyl(methyl)sulfamoyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)N(C)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO4S/c1-18(15-10-6-4-7-11-15,16-12-8-5-9-13-16)19(2)24(21,22)14-17(20)23-3/h4-13H,14H2,1-3H3 |
| InChIKey | LKMQEDZZZQJDJV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |