C11H11Cl4NO4S2 — CID 12769294
methyl 2-[phenyl(1,1,2,2-tetrachloroethylsulfanyl)sulfamoyl]acetate (PubChem CID 12769294) has the molecular formula C11H11Cl4NO4S2 and a molecular weight of 427.16 g/mol. Its IUPAC name is methyl 2-[phenyl(1,1,2,2-tetrachloroethylsulfanyl)sulfamoyl]acetate.
| Compound Name | methyl 2-[phenyl(1,1,2,2-tetrachloroethylsulfanyl)sulfamoyl]acetate |
|---|---|
| PubChem CID | 12769294 |
| Molecular Formula | C11H11Cl4NO4S2 |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 424.89 |
| IUPAC Name | methyl 2-[phenyl(1,1,2,2-tetrachloroethylsulfanyl)sulfamoyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)N(SC(Cl)(Cl)C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H11Cl4NO4S2/c1-20-9(17)7-22(18,19)16(8-5-3-2-4-6-8)21-11(14,15)10(12)13/h2-6,10H,7H2,1H3 |
| InChIKey | MGHUDEHVQJLFTR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|