C15H14Cl3NO2S2 — CID 126505274
N-phenyl-N-(1,1,2-trichloropropylsulfanyl)benzenesulfonamide (PubChem CID 126505274) has the molecular formula C15H14Cl3NO2S2 and a molecular weight of 410.78 g/mol. Its IUPAC name is N-phenyl-N-(1,1,2-trichloropropylsulfanyl)benzenesulfonamide.
| Compound Name | N-phenyl-N-(1,1,2-trichloropropylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 126505274 |
| Molecular Formula | C15H14Cl3NO2S2 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 408.95 |
| IUPAC Name | N-phenyl-N-(1,1,2-trichloropropylsulfanyl)benzenesulfonamide |
| SMILES | CC(Cl)C(Cl)(Cl)SN(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14Cl3NO2S2/c1-12(16)15(17,18)22-19(13-8-4-2-5-9-13)23(20,21)14-10-6-3-7-11-14/h2-12H,1H3 |
| InChIKey | ZUXCRKRBYPEQBL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|