C19H24Cl4F2N4O4S4 — CID 87802579
N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline;N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)-4-methylaniline (PubChem CID 87802579) has the molecular formula C19H24Cl4F2N4O4S4 and a molecular weight of 680.50 g/mol. Its IUPAC name is N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline;N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)-4-methylaniline.
| Compound Name | N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline;N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)-4-methylaniline |
|---|---|
| PubChem CID | 87802579 |
| Molecular Formula | C19H24Cl4F2N4O4S4 |
| Molecular Weight | 680.50 g/mol |
| Exact Mass | 677.94 |
| IUPAC Name | N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline;N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)-4-methylaniline |
| SMILES | CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)c1ccccc1.Cc1ccc(N(SC(F)(Cl)Cl)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C10H13Cl2FN2O2S2.C9H11Cl2FN2O2S2/c1-8-4-6-9(7-5-8)15(18-10(11,12)13)19(16,17)14(2)3;1-13(2)18(15,16)14(17-9(10,11)12)8-6-4-3-5-7-8/h4-7H,1-3H3;3-7H,1-2H3 |
| InChIKey | OYEJMSRPWYSMRE-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|