C9H11Cl2FN2O3S2 — CID 141055766
1,1-dichloro-N-(dimethylsulfamoyl)-1-fluoro-N-phenylmethanesulfinamide (PubChem CID 141055766) has the molecular formula C9H11Cl2FN2O3S2 and a molecular weight of 349.24 g/mol. Its IUPAC name is 1,1-dichloro-N-(dimethylsulfamoyl)-1-fluoro-N-phenylmethanesulfinamide.
| Compound Name | 1,1-dichloro-N-(dimethylsulfamoyl)-1-fluoro-N-phenylmethanesulfinamide |
|---|---|
| PubChem CID | 141055766 |
| Molecular Formula | C9H11Cl2FN2O3S2 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 1,1-dichloro-N-(dimethylsulfamoyl)-1-fluoro-N-phenylmethanesulfinamide |
| SMILES | CN(C)S(=O)(=O)N(c1ccccc1)S(=O)C(F)(Cl)Cl |
| InChI | InChI=1S/C9H11Cl2FN2O3S2/c1-13(2)19(16,17)14(18(15)9(10,11)12)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | WEXHNLGPQLJEQS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|