C17H16F6N2 — CID 161199121
1,1,1,3,3,3-hexafluoro-2-N,2-N'-dimethyl-2-N,2-N'-diphenylpropane-2,2-diamine (PubChem CID 161199121) has the molecular formula C17H16F6N2 and a molecular weight of 362.32 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-N,2-N'-dimethyl-2-N,2-N'-diphenylpropane-2,2-diamine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-N,2-N'-dimethyl-2-N,2-N'-diphenylpropane-2,2-diamine |
|---|---|
| PubChem CID | 161199121 |
| Molecular Formula | C17H16F6N2 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-N,2-N'-dimethyl-2-N,2-N'-diphenylpropane-2,2-diamine |
| SMILES | CN(c1ccccc1)C(N(C)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H16F6N2/c1-24(13-9-5-3-6-10-13)15(16(18,19)20,17(21,22)23)25(2)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | UUSYNYDZROPXEZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|