C8H9Cl2FN2O2S2 — CID 57246486
1-[[dichloro(fluoro)methyl]sulfanyl-sulfamoylamino]-4-methylbenzene (PubChem CID 57246486) has the molecular formula C8H9Cl2FN2O2S2 and a molecular weight of 319.21 g/mol. Its IUPAC name is 1-[[dichloro(fluoro)methyl]sulfanyl-sulfamoylamino]-4-methylbenzene.
| Compound Name | 1-[[dichloro(fluoro)methyl]sulfanyl-sulfamoylamino]-4-methylbenzene |
|---|---|
| PubChem CID | 57246486 |
| Molecular Formula | C8H9Cl2FN2O2S2 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 1-[[dichloro(fluoro)methyl]sulfanyl-sulfamoylamino]-4-methylbenzene |
| SMILES | Cc1ccc(N(SC(F)(Cl)Cl)S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C8H9Cl2FN2O2S2/c1-6-2-4-7(5-3-6)13(17(12,14)15)16-8(9,10)11/h2-5H,1H3,(H2,12,14,15) |
| InChIKey | VHGCXVXDBKXXEZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|