C12H15Cl2FN2O2S2 — CID 174724382
N-[dichloro(fluoro)methyl]sulfanyl-3-(dimethylamino)-N-phenylprop-2-ene-1-sulfonamide (PubChem CID 174724382) has the molecular formula C12H15Cl2FN2O2S2 and a molecular weight of 373.30 g/mol. Its IUPAC name is N-[dichloro(fluoro)methyl]sulfanyl-3-(dimethylamino)-N-phenylprop-2-ene-1-sulfonamide.
| Compound Name | N-[dichloro(fluoro)methyl]sulfanyl-3-(dimethylamino)-N-phenylprop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 174724382 |
| Molecular Formula | C12H15Cl2FN2O2S2 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | N-[dichloro(fluoro)methyl]sulfanyl-3-(dimethylamino)-N-phenylprop-2-ene-1-sulfonamide |
| SMILES | CN(C)C=CCS(=O)(=O)N(SC(F)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C12H15Cl2FN2O2S2/c1-16(2)9-6-10-21(18,19)17(20-12(13,14)15)11-7-4-3-5-8-11/h3-9H,10H2,1-2H3 |
| InChIKey | KFPVQWKIOWLOIQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|