C16H21Cl2FN6O5S2 — CID 88721475
N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline;(1E)-2-(ethylcarbamoylamino)-N-methoxy-2-oxoethanimidoyl cyanide (PubChem CID 88721475) has the molecular formula C16H21Cl2FN6O5S2 and a molecular weight of 531.42 g/mol. Its IUPAC name is N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline;(1E)-2-(ethylcarbamoylamino)-N-methoxy-2-oxoethanimidoyl cyanide.
| Compound Name | N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline;(1E)-2-(ethylcarbamoylamino)-N-methoxy-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 88721475 |
| Molecular Formula | C16H21Cl2FN6O5S2 |
| Molecular Weight | 531.42 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)aniline;(1E)-2-(ethylcarbamoylamino)-N-methoxy-2-oxoethanimidoyl cyanide |
| SMILES | CCNC(=O)NC(=O)/C(C#N)=N/OC.CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C9H11Cl2FN2O2S2.C7H10N4O3/c1-13(2)18(15,16)14(17-9(10,11)12)8-6-4-3-5-7-8;1-3-9-7(13)10-6(12)5(4-8)11-14-2/h3-7H,1-2H3;3H2,1-2H3,(H2,9,10,12,13)/b;11-5+ |
| InChIKey | DUKMADCLUVMIOG-QCXXUTHXSA-N |
| XLogP | 2.36 |
| TPSA | 144.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|