C9H13N3O6S — CID 23275236
2-[[(2Z)-2-cyano-2-methoxyiminoacetyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 23275236) has the molecular formula C9H13N3O6S and a molecular weight of 291.29 g/mol. Its IUPAC name is 2-[[(2Z)-2-cyano-2-methoxyiminoacetyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[(2Z)-2-cyano-2-methoxyiminoacetyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 23275236 |
| Molecular Formula | C9H13N3O6S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-[[(2Z)-2-cyano-2-methoxyiminoacetyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | CO/N=C(/C#N)C(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C9H13N3O6S/c1-18-12-7(5-10)8(13)11-6(9(14)15)3-4-19(2,16)17/h6H,3-4H2,1-2H3,(H,11,13)(H,14,15)/b12-7- |
| InChIKey | IISLXKSCBOJISI-GHXNOFRVSA-N |
| XLogP | -1.48 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|