C8H11N3O6S — CID 23274937
2-[[(2Z)-2-cyano-2-methoxyiminoacetyl]amino]-3-methylsulfonylpropanoic acid (PubChem CID 23274937) has the molecular formula C8H11N3O6S and a molecular weight of 277.26 g/mol. Its IUPAC name is 2-[[(2Z)-2-cyano-2-methoxyiminoacetyl]amino]-3-methylsulfonylpropanoic acid.
| Compound Name | 2-[[(2Z)-2-cyano-2-methoxyiminoacetyl]amino]-3-methylsulfonylpropanoic acid |
|---|---|
| PubChem CID | 23274937 |
| Molecular Formula | C8H11N3O6S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[[(2Z)-2-cyano-2-methoxyiminoacetyl]amino]-3-methylsulfonylpropanoic acid |
| SMILES | CO/N=C(/C#N)C(=O)NC(CS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C8H11N3O6S/c1-17-11-5(3-9)7(12)10-6(8(13)14)4-18(2,15)16/h6H,4H2,1-2H3,(H,10,12)(H,13,14)/b11-5- |
| InChIKey | QXSUWSRSNGKRQF-WZUFQYTHSA-N |
| XLogP | -1.87 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|