C6H5Cl3N4O2 — CID 117063855
(1E)-N-methoxy-2-oxo-2-[(2E)-2-(2,2,2-trichloroethylidene)hydrazinyl]ethanimidoyl cyanide (PubChem CID 117063855) has the molecular formula C6H5Cl3N4O2 and a molecular weight of 271.49 g/mol. Its IUPAC name is (1E)-N-methoxy-2-oxo-2-[(2E)-2-(2,2,2-trichloroethylidene)hydrazinyl]ethanimidoyl cyanide.
| Compound Name | (1E)-N-methoxy-2-oxo-2-[(2E)-2-(2,2,2-trichloroethylidene)hydrazinyl]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 117063855 |
| Molecular Formula | C6H5Cl3N4O2 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | (1E)-N-methoxy-2-oxo-2-[(2E)-2-(2,2,2-trichloroethylidene)hydrazinyl]ethanimidoyl cyanide |
| SMILES | CO/N=C(\C#N)C(=O)N/N=C/C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H5Cl3N4O2/c1-15-13-4(2-10)5(14)12-11-3-6(7,8)9/h3H,1H3,(H,12,14)/b11-3+,13-4+ |
| InChIKey | KEDDAIJIVUPALN-GFZHYVKTSA-N |
| XLogP | 0.98 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|