C8H9N3O2 — CID 88683228
2-(buta-2,3-dienylamino)-N-methoxy-2-oxoethanimidoyl cyanide (PubChem CID 88683228) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-(buta-2,3-dienylamino)-N-methoxy-2-oxoethanimidoyl cyanide.
| Compound Name | 2-(buta-2,3-dienylamino)-N-methoxy-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 88683228 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-(buta-2,3-dienylamino)-N-methoxy-2-oxoethanimidoyl cyanide |
| SMILES | C=C=CCNC(=O)C(C#N)=NOC |
| InChI | InChI=1S/C8H9N3O2/c1-3-4-5-10-8(12)7(6-9)11-13-2/h4H,1,5H2,2H3,(H,10,12) |
| InChIKey | PCWDKACKGBPMFV-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|