C6H7N3O3 — CID 91361912
2-acetamido-N-methoxy-2-oxoethanimidoyl cyanide (PubChem CID 91361912) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 2-acetamido-N-methoxy-2-oxoethanimidoyl cyanide.
| Compound Name | 2-acetamido-N-methoxy-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 91361912 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 2-acetamido-N-methoxy-2-oxoethanimidoyl cyanide |
| SMILES | CON=C(C#N)C(=O)NC(C)=O |
| InChI | InChI=1S/C6H7N3O3/c1-4(10)8-6(11)5(3-7)9-12-2/h1-2H3,(H,8,10,11) |
| InChIKey | FQDRCTHNEVCTDB-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|