C13H10F4N4O4 — CID 57069423
N-methoxy-2-oxo-2-[[4-(1,2,2,2-tetrafluoroethoxy)phenyl]carbamoylamino]ethanimidoyl cyanide (PubChem CID 57069423) has the molecular formula C13H10F4N4O4 and a molecular weight of 362.24 g/mol. Its IUPAC name is N-methoxy-2-oxo-2-[[4-(1,2,2,2-tetrafluoroethoxy)phenyl]carbamoylamino]ethanimidoyl cyanide.
| Compound Name | N-methoxy-2-oxo-2-[[4-(1,2,2,2-tetrafluoroethoxy)phenyl]carbamoylamino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 57069423 |
| Molecular Formula | C13H10F4N4O4 |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-methoxy-2-oxo-2-[[4-(1,2,2,2-tetrafluoroethoxy)phenyl]carbamoylamino]ethanimidoyl cyanide |
| SMILES | CON=C(C#N)C(=O)NC(=O)Nc1ccc(OC(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H10F4N4O4/c1-24-21-9(6-18)10(22)20-12(23)19-7-2-4-8(5-3-7)25-11(14)13(15,16)17/h2-5,11H,1H3,(H2,19,20,22,23) |
| InChIKey | HYRWAPOHUIVYRD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|