C5H5N3O4 — CID 91248442
(2-cyano-2-methoxyiminoacetyl)carbamic acid (PubChem CID 91248442) has the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. Its IUPAC name is (2-cyano-2-methoxyiminoacetyl)carbamic acid.
| Compound Name | (2-cyano-2-methoxyiminoacetyl)carbamic acid |
|---|---|
| PubChem CID | 91248442 |
| Molecular Formula | C5H5N3O4 |
| Molecular Weight | 171.11 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | (2-cyano-2-methoxyiminoacetyl)carbamic acid |
| SMILES | CON=C(C#N)C(=O)NC(=O)O |
| InChI | InChI=1S/C5H5N3O4/c1-12-8-3(2-6)4(9)7-5(10)11/h1H3,(H,7,9)(H,10,11) |
| InChIKey | DRBKPOPPQRBTLH-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.11 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|