C11H11F4NO4S2 — CID 174675629
4,4,4-trifluoro-N-(fluoromethylsulfonyl)-N-phenylbut-2-ene-1-sulfonamide (PubChem CID 174675629) has the molecular formula C11H11F4NO4S2 and a molecular weight of 361.34 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(fluoromethylsulfonyl)-N-phenylbut-2-ene-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-(fluoromethylsulfonyl)-N-phenylbut-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 174675629 |
| Molecular Formula | C11H11F4NO4S2 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 4,4,4-trifluoro-N-(fluoromethylsulfonyl)-N-phenylbut-2-ene-1-sulfonamide |
| SMILES | O=S(=O)(CF)N(c1ccccc1)S(=O)(=O)CC=CC(F)(F)F |
| InChI | InChI=1S/C11H11F4NO4S2/c12-9-22(19,20)16(10-5-2-1-3-6-10)21(17,18)8-4-7-11(13,14)15/h1-7H,8-9H2 |
| InChIKey | DVRQURDHMXSUDV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|