C15H11Cl4NOS — CID 54288975
N-phenyl-N-(1,1,2,2-tetrachloroethylsulfanyl)benzamide (PubChem CID 54288975) has the molecular formula C15H11Cl4NOS and a molecular weight of 395.14 g/mol. Its IUPAC name is N-phenyl-N-(1,1,2,2-tetrachloroethylsulfanyl)benzamide.
| Compound Name | N-phenyl-N-(1,1,2,2-tetrachloroethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 54288975 |
| Molecular Formula | C15H11Cl4NOS |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 392.93 |
| IUPAC Name | N-phenyl-N-(1,1,2,2-tetrachloroethylsulfanyl)benzamide |
| SMILES | O=C(c1ccccc1)N(SC(Cl)(Cl)C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C15H11Cl4NOS/c16-14(17)15(18,19)22-20(12-9-5-2-6-10-12)13(21)11-7-3-1-4-8-11/h1-10,14H |
| InChIKey | RWDRSHBLYPAOIT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|