About N,N-dibenzoylcarbamoyl chloride
N,N-dibenzoylcarbamoyl chloride (PubChem CID 151011210) has the molecular formula C15H10ClNO3
and a molecular weight of 287.70 g/mol. Its IUPAC name is N,N-dibenzoylcarbamoyl chloride.
Molecular Properties
| Compound Name | N,N-dibenzoylcarbamoyl chloride |
| PubChem CID | 151011210 |
| Molecular Formula | C15H10ClNO3 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N,N-dibenzoylcarbamoyl chloride |
| SMILES | O=C(Cl)N(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H10ClNO3/c16-15(20)17(13(18)11-7-3-1-4-8-11)14(19)12-9-5-2-6-10-12/h1-10H |
| InChIKey | LWDFRYZPWBLPLS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibenzoylcarbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzoylcarbamoyl chloride?
The IUPAC name of N,N-dibenzoylcarbamoyl chloride (CID 151011210) is N,N-dibenzoylcarbamoyl chloride.
What is the SMILES notation for N,N-dibenzoylcarbamoyl chloride?
The canonical SMILES for N,N-dibenzoylcarbamoyl chloride is O=C(Cl)N(C(=O)c1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of N,N-dibenzoylcarbamoyl chloride?
The InChIKey is LWDFRYZPWBLPLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClNO3/c16-15(20)17(13(18)11-7-3-1-4-8-11)14(19)12-9-5-2-6-10-12/h1-10H.
What are the key properties of N,N-dibenzoylcarbamoyl chloride?
N,N-dibenzoylcarbamoyl chloride has a molecular weight of 287.70 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzoylcarbamoyl chloride is sourced from PubChem (CID 151011210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).