About 1-phenylethanone;bis(yttrium)
1-phenylethanone;bis(yttrium) (PubChem CID 58212087) has the molecular formula C8H7OY2-
and a molecular weight of 296.95 g/mol. Its IUPAC name is 1-phenylethanone;bis(yttrium).
Molecular Properties
| Compound Name | 1-phenylethanone;bis(yttrium) |
| PubChem CID | 58212087 |
| Molecular Formula | C8H7OY2- |
| Molecular Weight | 296.95 g/mol |
| Exact Mass | 296.86 |
| IUPAC Name | 1-phenylethanone;bis(yttrium) |
| SMILES | [CH2-]C(=O)c1ccccc1.[Y].[Y] |
| InChI | InChI=1S/C8H7O.2Y/c1-7(9)8-5-3-2-4-6-8;;/h2-6H,1H2;;/q-1;; |
| InChIKey | IODOHWVOYKODAK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.95 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethanone;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanone;bis(yttrium)?
The IUPAC name of 1-phenylethanone;bis(yttrium) (CID 58212087) is 1-phenylethanone;bis(yttrium).
What is the SMILES notation for 1-phenylethanone;bis(yttrium)?
The canonical SMILES for 1-phenylethanone;bis(yttrium) is [CH2-]C(=O)c1ccccc1.[Y].[Y].
What is the InChIKey of 1-phenylethanone;bis(yttrium)?
The InChIKey is IODOHWVOYKODAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7O.2Y/c1-7(9)8-5-3-2-4-6-8;;/h2-6H,1H2;;/q-1;;.
What are the key properties of 1-phenylethanone;bis(yttrium)?
1-phenylethanone;bis(yttrium) has a molecular weight of 296.95 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanone;bis(yttrium) is sourced from PubChem (CID 58212087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).