C12H11NaO7S2 — CID 175093945
sodium;hydride;2-(2-sulfophenoxy)benzenesulfonic acid (PubChem CID 175093945) has the molecular formula C12H11NaO7S2 and a molecular weight of 354.34 g/mol. Its IUPAC name is sodium;hydride;2-(2-sulfophenoxy)benzenesulfonic acid.
| Compound Name | sodium;hydride;2-(2-sulfophenoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 175093945 |
| Molecular Formula | C12H11NaO7S2 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | sodium;hydride;2-(2-sulfophenoxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1Oc1ccccc1S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C12H10O7S2.Na.H/c13-20(14,15)11-7-3-1-5-9(11)19-10-6-2-4-8-12(10)21(16,17)18;;/h1-8H,(H,13,14,15)(H,16,17,18);;/q;+1;-1 |
| InChIKey | AGLNMZAPRFEDDH-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|