About potassium;2-formyloxybenzenesulfonic acid;hydride
potassium;2-formyloxybenzenesulfonic acid;hydride (PubChem CID 174717304) has the molecular formula C7H7KO5S
and a molecular weight of 242.29 g/mol. Its IUPAC name is potassium;2-formyloxybenzenesulfonic acid;hydride.
Molecular Properties
| Compound Name | potassium;2-formyloxybenzenesulfonic acid;hydride |
| PubChem CID | 174717304 |
| Molecular Formula | C7H7KO5S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | potassium;2-formyloxybenzenesulfonic acid;hydride |
| SMILES | O=COc1ccccc1S(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C7H6O5S.K.H/c8-5-12-6-3-1-2-4-7(6)13(9,10)11;;/h1-5H,(H,9,10,11);;/q;+1;-1 |
| InChIKey | UXCLOFBTJWRTFT-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-formyloxybenzenesulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-formyloxybenzenesulfonic acid;hydride?
The IUPAC name of potassium;2-formyloxybenzenesulfonic acid;hydride (CID 174717304) is potassium;2-formyloxybenzenesulfonic acid;hydride.
What is the SMILES notation for potassium;2-formyloxybenzenesulfonic acid;hydride?
The canonical SMILES for potassium;2-formyloxybenzenesulfonic acid;hydride is O=COc1ccccc1S(=O)(=O)O.[H-].[K+].
What is the InChIKey of potassium;2-formyloxybenzenesulfonic acid;hydride?
The InChIKey is UXCLOFBTJWRTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5S.K.H/c8-5-12-6-3-1-2-4-7(6)13(9,10)11;;/h1-5H,(H,9,10,11);;/q;+1;-1.
What are the key properties of potassium;2-formyloxybenzenesulfonic acid;hydride?
potassium;2-formyloxybenzenesulfonic acid;hydride has a molecular weight of 242.29 g/mol, XLogP of -2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-formyloxybenzenesulfonic acid;hydride is sourced from PubChem (CID 174717304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).