C20H23N7O2 — CID 124938470
(2R)-2-[4-(phenoxymethyl)triazol-1-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 124938470) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is (2R)-2-[4-(phenoxymethyl)triazol-1-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | (2R)-2-[4-(phenoxymethyl)triazol-1-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 124938470 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2R)-2-[4-(phenoxymethyl)triazol-1-yl]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | C[C@H](C(=O)N1CCN(c2ncccn2)CC1)n1cc(COc2ccccc2)nn1 |
| InChI | InChI=1S/C20H23N7O2/c1-16(27-14-17(23-24-27)15-29-18-6-3-2-4-7-18)19(28)25-10-12-26(13-11-25)20-21-8-5-9-22-20/h2-9,14,16H,10-13,15H2,1H3/t16-/m1/s1 |
| InChIKey | SQEJOJBZUSAHKQ-MRXNPFEDSA-N |
| XLogP | 1.56 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |