About (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane
(6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane (PubChem CID 124938715) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane.
Molecular Properties
| Compound Name | (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane |
| PubChem CID | 124938715 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane |
| SMILES | c1cc2[nH]ncc2cc1C[C@H]1CNCCOC1 |
| InChI | InChI=1S/C13H17N3O/c1-2-13-12(8-15-16-13)6-10(1)5-11-7-14-3-4-17-9-11/h1-2,6,8,11,14H,3-5,7,9H2,(H,15,16)/t11-/m0/s1 |
| InChIKey | FWJGBBRDVOIFNU-NSHDSACASA-N |
| XLogP | 1.34 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane?
The IUPAC name of (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane (CID 124938715) is (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane.
What is the SMILES notation for (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane?
The canonical SMILES for (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane is c1cc2[nH]ncc2cc1C[C@H]1CNCCOC1.
What is the InChIKey of (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane?
The InChIKey is FWJGBBRDVOIFNU-NSHDSACASA-N. The full InChI is InChI=1S/C13H17N3O/c1-2-13-12(8-15-16-13)6-10(1)5-11-7-14-3-4-17-9-11/h1-2,6,8,11,14H,3-5,7,9H2,(H,15,16)/t11-/m0/s1.
What are the key properties of (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane?
(6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane has a molecular weight of 231.30 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-(1H-indazol-5-ylmethyl)-1,4-oxazepane is sourced from PubChem (CID 124938715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).