C17H24N4O4S — CID 124943564
(2S)-4-[3-(1,1-dioxothiazinan-2-yl)benzoyl]-N-methylpiperazine-2-carboxamide (PubChem CID 124943564) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is (2S)-4-[3-(1,1-dioxothiazinan-2-yl)benzoyl]-N-methylpiperazine-2-carboxamide.
| Compound Name | (2S)-4-[3-(1,1-dioxothiazinan-2-yl)benzoyl]-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 124943564 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2S)-4-[3-(1,1-dioxothiazinan-2-yl)benzoyl]-N-methylpiperazine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1CN(C(=O)c2cccc(N3CCCCS3(=O)=O)c2)CCN1 |
| InChI | InChI=1S/C17H24N4O4S/c1-18-16(22)15-12-20(9-7-19-15)17(23)13-5-4-6-14(11-13)21-8-2-3-10-26(21,24)25/h4-6,11,15,19H,2-3,7-10,12H2,1H3,(H,18,22)/t15-/m0/s1 |
| InChIKey | BDNNKMKWQVHLHP-HNNXBMFYSA-N |
| XLogP | -0.22 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |