C24H28N6O3 — CID 124960916
3-(4-methoxy-N-methylanilino)-1-[(2S)-2-[6-(pyrazin-2-ylamino)-2-pyridinyl]morpholin-4-yl]propan-1-one (PubChem CID 124960916) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 3-(4-methoxy-N-methylanilino)-1-[(2S)-2-[6-(pyrazin-2-ylamino)-2-pyridinyl]morpholin-4-yl]propan-1-one.
| Compound Name | 3-(4-methoxy-N-methylanilino)-1-[(2S)-2-[6-(pyrazin-2-ylamino)-2-pyridinyl]morpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 124960916 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 3-(4-methoxy-N-methylanilino)-1-[(2S)-2-[6-(pyrazin-2-ylamino)-2-pyridinyl]morpholin-4-yl]propan-1-one |
| SMILES | COc1ccc(N(C)CCC(=O)N2CCO[C@H](c3cccc(Nc4cnccn4)n3)C2)cc1 |
| InChI | InChI=1S/C24H28N6O3/c1-29(18-6-8-19(32-2)9-7-18)13-10-24(31)30-14-15-33-21(17-30)20-4-3-5-22(27-20)28-23-16-25-11-12-26-23/h3-9,11-12,16,21H,10,13-15,17H2,1-2H3,(H,26,27,28)/t21-/m0/s1 |
| InChIKey | GXWBOLYKCQAIQK-NRFANRHFSA-N |
| XLogP | 3.05 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|