C19H24N4O3 — CID 124963732
(6-imidazol-1-yl-3-pyridinyl)-[(5R)-5-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone (PubChem CID 124963732) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is (6-imidazol-1-yl-3-pyridinyl)-[(5R)-5-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone.
| Compound Name | (6-imidazol-1-yl-3-pyridinyl)-[(5R)-5-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone |
|---|---|
| PubChem CID | 124963732 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (6-imidazol-1-yl-3-pyridinyl)-[(5R)-5-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone |
| SMILES | CO[C@@H]1CCCOC12CCN(C(=O)c1ccc(-n3ccnc3)nc1)CC2 |
| InChI | InChI=1S/C19H24N4O3/c1-25-16-3-2-12-26-19(16)6-9-22(10-7-19)18(24)15-4-5-17(21-13-15)23-11-8-20-14-23/h4-5,8,11,13-14,16H,2-3,6-7,9-10,12H2,1H3/t16-/m1/s1 |
| InChIKey | HSLJNNUCTLECQV-MRXNPFEDSA-N |
| XLogP | 2.07 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |