C14H16N4O2 — CID 43417527
(4-hydroxypiperidin-1-yl)-(6-imidazol-1-yl-3-pyridinyl)methanone (PubChem CID 43417527) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is (4-hydroxypiperidin-1-yl)-(6-imidazol-1-yl-3-pyridinyl)methanone.
| Compound Name | (4-hydroxypiperidin-1-yl)-(6-imidazol-1-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 43417527 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (4-hydroxypiperidin-1-yl)-(6-imidazol-1-yl-3-pyridinyl)methanone |
| SMILES | O=C(c1ccc(-n2ccnc2)nc1)N1CCC(O)CC1 |
| InChI | InChI=1S/C14H16N4O2/c19-12-3-6-17(7-4-12)14(20)11-1-2-13(16-9-11)18-8-5-15-10-18/h1-2,5,8-10,12,19H,3-4,6-7H2 |
| InChIKey | YQJPGEGQSHAXFQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |