C22H23N5O2 — CID 32772858
(4-ethylphenyl)-[4-(6-imidazol-1-ylpyridine-3-carbonyl)piperazin-1-yl]methanone (PubChem CID 32772858) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is (4-ethylphenyl)-[4-(6-imidazol-1-ylpyridine-3-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (4-ethylphenyl)-[4-(6-imidazol-1-ylpyridine-3-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 32772858 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (4-ethylphenyl)-[4-(6-imidazol-1-ylpyridine-3-carbonyl)piperazin-1-yl]methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)c3ccc(-n4ccnc4)nc3)CC2)cc1 |
| InChI | InChI=1S/C22H23N5O2/c1-2-17-3-5-18(6-4-17)21(28)25-11-13-26(14-12-25)22(29)19-7-8-20(24-15-19)27-10-9-23-16-27/h3-10,15-16H,2,11-14H2,1H3 |
| InChIKey | KHWARVPKEQILDI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |