C16H18N4O3 — CID 97314443
ethyl (2R)-1-(6-imidazol-1-ylpyridine-3-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 97314443) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is ethyl (2R)-1-(6-imidazol-1-ylpyridine-3-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2R)-1-(6-imidazol-1-ylpyridine-3-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 97314443 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | ethyl (2R)-1-(6-imidazol-1-ylpyridine-3-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN1C(=O)c1ccc(-n2ccnc2)nc1 |
| InChI | InChI=1S/C16H18N4O3/c1-2-23-16(22)13-4-3-8-20(13)15(21)12-5-6-14(18-10-12)19-9-7-17-11-19/h5-7,9-11,13H,2-4,8H2,1H3/t13-/m1/s1 |
| InChIKey | FCPVCCZDSCRPKZ-CYBMUJFWSA-N |
| XLogP | 1.43 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |