C15H19N3O5S — CID 124964528
6-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione (PubChem CID 124964528) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 6-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione.
| Compound Name | 6-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 124964528 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 6-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(S(=O)(=O)N3CCCC[C@H]3CCO)ccc2[nH]1 |
| InChI | InChI=1S/C15H19N3O5S/c19-8-6-10-3-1-2-7-18(10)24(22,23)11-4-5-13-12(9-11)14(20)17-15(21)16-13/h4-5,9-10,19H,1-3,6-8H2,(H2,16,17,20,21)/t10-/m0/s1 |
| InChIKey | HYBWSBVUBFAJNS-JTQLQIEISA-N |
| XLogP | 0.14 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |