C19H26N4O4S — CID 51589278
6-[(2S)-2-(piperidin-1-ylmethyl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione (PubChem CID 51589278) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 6-[(2S)-2-(piperidin-1-ylmethyl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione.
| Compound Name | 6-[(2S)-2-(piperidin-1-ylmethyl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 51589278 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 6-[(2S)-2-(piperidin-1-ylmethyl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(S(=O)(=O)N3CCCC[C@H]3CN3CCCCC3)ccc2[nH]1 |
| InChI | InChI=1S/C19H26N4O4S/c24-18-16-12-15(7-8-17(16)20-19(25)21-18)28(26,27)23-11-5-2-6-14(23)13-22-9-3-1-4-10-22/h7-8,12,14H,1-6,9-11,13H2,(H2,20,21,24,25)/t14-/m0/s1 |
| InChIKey | NZODQKHYJVFBSG-AWEZNQCLSA-N |
| XLogP | 1.25 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |