C19H29N3O — CID 124967719
1-[(3R)-3-[ethyl(methyl)amino]-1-azaspiro[4.5]decan-1-yl]-2-pyridin-2-ylethanone (PubChem CID 124967719) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-[(3R)-3-[ethyl(methyl)amino]-1-azaspiro[4.5]decan-1-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[(3R)-3-[ethyl(methyl)amino]-1-azaspiro[4.5]decan-1-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 124967719 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 1-[(3R)-3-[ethyl(methyl)amino]-1-azaspiro[4.5]decan-1-yl]-2-pyridin-2-ylethanone |
| SMILES | CCN(C)[C@H]1CN(C(=O)Cc2ccccn2)C2(CCCCC2)C1 |
| InChI | InChI=1S/C19H29N3O/c1-3-21(2)17-14-19(10-6-4-7-11-19)22(15-17)18(23)13-16-9-5-8-12-20-16/h5,8-9,12,17H,3-4,6-7,10-11,13-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | IVEFYXWNCWFJFB-QGZVFWFLSA-N |
| XLogP | 2.88 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |