C24H31N3O — CID 110137503
1-[(2R,3aS,9aS)-2-benzyl-3a-methyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[3,2-b]azocin-4-yl]-2-pyridin-2-ylethanone (PubChem CID 110137503) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-[(2R,3aS,9aS)-2-benzyl-3a-methyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[3,2-b]azocin-4-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[(2R,3aS,9aS)-2-benzyl-3a-methyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[3,2-b]azocin-4-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 110137503 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 1-[(2R,3aS,9aS)-2-benzyl-3a-methyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[3,2-b]azocin-4-yl]-2-pyridin-2-ylethanone |
| SMILES | C[C@]12C[C@@H](Cc3ccccc3)N[C@H]1CCCCCN2C(=O)Cc1ccccn1 |
| InChI | InChI=1S/C24H31N3O/c1-24-18-21(16-19-10-4-2-5-11-19)26-22(24)13-6-3-9-15-27(24)23(28)17-20-12-7-8-14-25-20/h2,4-5,7-8,10-12,14,21-22,26H,3,6,9,13,15-18H2,1H3/t21-,22+,24+/m1/s1 |
| InChIKey | GYOIXQLNDXPPSO-GPXNEJASSA-N |
| XLogP | 3.76 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |