C26H31FN2O — CID 124968009
[(1R)-3,4-dimethylcyclohex-3-en-1-yl]-[4-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone (PubChem CID 124968009) has the molecular formula C26H31FN2O and a molecular weight of 406.55 g/mol. Its IUPAC name is [(1R)-3,4-dimethylcyclohex-3-en-1-yl]-[4-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone.
| Compound Name | [(1R)-3,4-dimethylcyclohex-3-en-1-yl]-[4-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124968009 |
| Molecular Formula | C26H31FN2O |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | [(1R)-3,4-dimethylcyclohex-3-en-1-yl]-[4-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]methanone |
| SMILES | CC1=C(C)C[C@H](C(=O)N2CCC(c3ccc(Cc4ccccc4F)cn3)CC2)CC1 |
| InChI | InChI=1S/C26H31FN2O/c1-18-7-9-23(15-19(18)2)26(30)29-13-11-21(12-14-29)25-10-8-20(17-28-25)16-22-5-3-4-6-24(22)27/h3-6,8,10,17,21,23H,7,9,11-16H2,1-2H3/t23-/m1/s1 |
| InChIKey | IXQUSIGKEVPWAY-HSZRJFAPSA-N |
| XLogP | 5.65 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|