C24H30FN3O2 — CID 92616486
3-[4-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylpropan-1-one (PubChem CID 92616486) has the molecular formula C24H30FN3O2 and a molecular weight of 411.52 g/mol. Its IUPAC name is 3-[4-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 3-[4-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 92616486 |
| Molecular Formula | C24H30FN3O2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-[4-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]piperidin-1-yl]-1-morpholin-4-ylpropan-1-one |
| SMILES | O=C(CCN1CCC(c2ccc(Cc3ccccc3F)cn2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C24H30FN3O2/c25-22-4-2-1-3-21(22)17-19-5-6-23(26-18-19)20-7-10-27(11-8-20)12-9-24(29)28-13-15-30-16-14-28/h1-6,18,20H,7-17H2 |
| InChIKey | LIALWKAXDMOLEM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |