C24H23F2N3O2 — CID 127250139
N-(2-fluorophenyl)-2-[2-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]morpholin-4-yl]acetamide (PubChem CID 127250139) has the molecular formula C24H23F2N3O2 and a molecular weight of 423.46 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[2-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]morpholin-4-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[2-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 127250139 |
| Molecular Formula | C24H23F2N3O2 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-(2-fluorophenyl)-2-[2-[5-[(2-fluorophenyl)methyl]-2-pyridinyl]morpholin-4-yl]acetamide |
| SMILES | O=C(CN1CCOC(c2ccc(Cc3ccccc3F)cn2)C1)Nc1ccccc1F |
| InChI | InChI=1S/C24H23F2N3O2/c25-19-6-2-1-5-18(19)13-17-9-10-22(27-14-17)23-15-29(11-12-31-23)16-24(30)28-21-8-4-3-7-20(21)26/h1-10,14,23H,11-13,15-16H2,(H,28,30) |
| InChIKey | IZENUSTYDDUOIP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |