C16H23N5 — CID 124971396
4-methyl-2-[(3R)-piperidin-3-yl]-6-(2-propylpyrazol-3-yl)pyrimidine (PubChem CID 124971396) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-methyl-2-[(3R)-piperidin-3-yl]-6-(2-propylpyrazol-3-yl)pyrimidine.
| Compound Name | 4-methyl-2-[(3R)-piperidin-3-yl]-6-(2-propylpyrazol-3-yl)pyrimidine |
|---|---|
| PubChem CID | 124971396 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-methyl-2-[(3R)-piperidin-3-yl]-6-(2-propylpyrazol-3-yl)pyrimidine |
| SMILES | CCCn1nccc1-c1cc(C)nc([C@@H]2CCCNC2)n1 |
| InChI | InChI=1S/C16H23N5/c1-3-9-21-15(6-8-18-21)14-10-12(2)19-16(20-14)13-5-4-7-17-11-13/h6,8,10,13,17H,3-5,7,9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | JWEBPZREENCGIY-CYBMUJFWSA-N |
| XLogP | 2.53 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |