C20H22FN3O2 — CID 124973479
N-[[6-[(2S)-1-[2-(3-fluorophenyl)acetyl]pyrrolidin-2-yl]-3-pyridinyl]methyl]acetamide (PubChem CID 124973479) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is N-[[6-[(2S)-1-[2-(3-fluorophenyl)acetyl]pyrrolidin-2-yl]-3-pyridinyl]methyl]acetamide.
| Compound Name | N-[[6-[(2S)-1-[2-(3-fluorophenyl)acetyl]pyrrolidin-2-yl]-3-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 124973479 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[[6-[(2S)-1-[2-(3-fluorophenyl)acetyl]pyrrolidin-2-yl]-3-pyridinyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc([C@@H]2CCCN2C(=O)Cc2cccc(F)c2)nc1 |
| InChI | InChI=1S/C20H22FN3O2/c1-14(25)22-12-16-7-8-18(23-13-16)19-6-3-9-24(19)20(26)11-15-4-2-5-17(21)10-15/h2,4-5,7-8,10,13,19H,3,6,9,11-12H2,1H3,(H,22,25)/t19-/m0/s1 |
| InChIKey | KKHNEACXORIYNI-IBGZPJMESA-N |
| XLogP | 2.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |