C27H40N4O4 — CID 124988963
N-[(2R)-2-[(1S,4R,5S,6S,8R)-4-(dimethylamino)-5-hydroxy-6-methyl-8-phenyl-10-oxabicyclo[4.3.1]decan-1-yl]-2-hydroxyethyl]-2-(3,5-dimethylpyrazol-1-yl)acetamide (PubChem CID 124988963) has the molecular formula C27H40N4O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-[(2R)-2-[(1S,4R,5S,6S,8R)-4-(dimethylamino)-5-hydroxy-6-methyl-8-phenyl-10-oxabicyclo[4.3.1]decan-1-yl]-2-hydroxyethyl]-2-(3,5-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-[(2R)-2-[(1S,4R,5S,6S,8R)-4-(dimethylamino)-5-hydroxy-6-methyl-8-phenyl-10-oxabicyclo[4.3.1]decan-1-yl]-2-hydroxyethyl]-2-(3,5-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 124988963 |
| Molecular Formula | C27H40N4O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | N-[(2R)-2-[(1S,4R,5S,6S,8R)-4-(dimethylamino)-5-hydroxy-6-methyl-8-phenyl-10-oxabicyclo[4.3.1]decan-1-yl]-2-hydroxyethyl]-2-(3,5-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)NC[C@@H](O)[C@]23CC[C@@H](N(C)C)[C@H](O)[C@](C)(C[C@@H](c4ccccc4)C2)O3)n1 |
| InChI | InChI=1S/C27H40N4O4/c1-18-13-19(2)31(29-18)17-24(33)28-16-23(32)27-12-11-22(30(4)5)25(34)26(3,35-27)14-21(15-27)20-9-7-6-8-10-20/h6-10,13,21-23,25,32,34H,11-12,14-17H2,1-5H3,(H,28,33)/t21-,22-,23-,25+,26+,27+/m1/s1 |
| InChIKey | OQVVNYNNFUDTSG-UBSPVUBISA-N |
| XLogP | 2.15 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |