C15H19N5O — CID 124989647
1-[(3R)-3-[3-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperidin-1-yl]ethanone (PubChem CID 124989647) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-[(3R)-3-[3-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-[3-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124989647 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-[(3R)-3-[3-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H](c2nccnc2-c2cnn(C)c2)C1 |
| InChI | InChI=1S/C15H19N5O/c1-11(21)20-7-3-4-12(10-20)14-15(17-6-5-16-14)13-8-18-19(2)9-13/h5-6,8-9,12H,3-4,7,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | OVVVBRAFJNCSSM-GFCCVEGCSA-N |
| XLogP | 1.60 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |