C15H22N4O2 — CID 110257328
1-[3-(3-morpholin-4-ylpyrazin-2-yl)piperidin-1-yl]ethanone (PubChem CID 110257328) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-[3-(3-morpholin-4-ylpyrazin-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 1-[3-(3-morpholin-4-ylpyrazin-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110257328 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-[3-(3-morpholin-4-ylpyrazin-2-yl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(c2nccnc2N2CCOCC2)C1 |
| InChI | InChI=1S/C15H22N4O2/c1-12(20)19-6-2-3-13(11-19)14-15(17-5-4-16-14)18-7-9-21-10-8-18/h4-5,13H,2-3,6-11H2,1H3 |
| InChIKey | FKLOHIAAKBCXCN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |