C20H34N4O3 — CID 124995477
2-[(3R)-3-[(1S,3S,7S,10S,11R)-11-hydroxy-1,12-dimethyl-5,12-diazatricyclo[5.3.1.13,10]dodecane-5-carbonyl]piperidin-1-yl]acetamide (PubChem CID 124995477) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-[(3R)-3-[(1S,3S,7S,10S,11R)-11-hydroxy-1,12-dimethyl-5,12-diazatricyclo[5.3.1.13,10]dodecane-5-carbonyl]piperidin-1-yl]acetamide.
| Compound Name | 2-[(3R)-3-[(1S,3S,7S,10S,11R)-11-hydroxy-1,12-dimethyl-5,12-diazatricyclo[5.3.1.13,10]dodecane-5-carbonyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 124995477 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 2-[(3R)-3-[(1S,3S,7S,10S,11R)-11-hydroxy-1,12-dimethyl-5,12-diazatricyclo[5.3.1.13,10]dodecane-5-carbonyl]piperidin-1-yl]acetamide |
| SMILES | CN1[C@@H]2CN(C(=O)[C@@H]3CCCN(CC(N)=O)C3)C[C@@H]3CC[C@H]1[C@](C)(C2)[C@@H]3O |
| InChI | InChI=1S/C20H34N4O3/c1-20-8-15-11-24(10-13(18(20)26)5-6-16(20)22(15)2)19(27)14-4-3-7-23(9-14)12-17(21)25/h13-16,18,26H,3-12H2,1-2H3,(H2,21,25)/t13-,14+,15-,16-,18+,20-/m0/s1 |
| InChIKey | QMMKVXSVGBTLTC-QWTNRPNDSA-N |
| XLogP | -0.12 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |