C18H25N3O4 — CID 70729938
2-[3-[3-(3-methoxyphenoxy)azetidine-1-carbonyl]piperidin-1-yl]acetamide (PubChem CID 70729938) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[3-[3-(3-methoxyphenoxy)azetidine-1-carbonyl]piperidin-1-yl]acetamide.
| Compound Name | 2-[3-[3-(3-methoxyphenoxy)azetidine-1-carbonyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 70729938 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-[3-[3-(3-methoxyphenoxy)azetidine-1-carbonyl]piperidin-1-yl]acetamide |
| SMILES | COc1cccc(OC2CN(C(=O)C3CCCN(CC(N)=O)C3)C2)c1 |
| InChI | InChI=1S/C18H25N3O4/c1-24-14-5-2-6-15(8-14)25-16-10-21(11-16)18(23)13-4-3-7-20(9-13)12-17(19)22/h2,5-6,8,13,16H,3-4,7,9-12H2,1H3,(H2,19,22) |
| InChIKey | JAELQCLBGNTWSU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |