C19H26N2O3 — CID 97202927
1-[(3R)-3-[3-(3-methylphenoxy)azetidine-1-carbonyl]piperidin-1-yl]propan-1-one (PubChem CID 97202927) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[(3R)-3-[3-(3-methylphenoxy)azetidine-1-carbonyl]piperidin-1-yl]propan-1-one.
| Compound Name | 1-[(3R)-3-[3-(3-methylphenoxy)azetidine-1-carbonyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 97202927 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[(3R)-3-[3-(3-methylphenoxy)azetidine-1-carbonyl]piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC[C@@H](C(=O)N2CC(Oc3cccc(C)c3)C2)C1 |
| InChI | InChI=1S/C19H26N2O3/c1-3-18(22)20-9-5-7-15(11-20)19(23)21-12-17(13-21)24-16-8-4-6-14(2)10-16/h4,6,8,10,15,17H,3,5,7,9,11-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | DFARODCUTMNFJO-OAHLLOKOSA-N |
| XLogP | 2.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |