C21H28N2O4 — CID 125178800
[3-(3-methylphenoxy)azetidin-1-yl]-[1-[(2S)-oxolane-2-carbonyl]piperidin-4-yl]methanone (PubChem CID 125178800) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is [3-(3-methylphenoxy)azetidin-1-yl]-[1-[(2S)-oxolane-2-carbonyl]piperidin-4-yl]methanone.
| Compound Name | [3-(3-methylphenoxy)azetidin-1-yl]-[1-[(2S)-oxolane-2-carbonyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 125178800 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [3-(3-methylphenoxy)azetidin-1-yl]-[1-[(2S)-oxolane-2-carbonyl]piperidin-4-yl]methanone |
| SMILES | Cc1cccc(OC2CN(C(=O)C3CCN(C(=O)[C@@H]4CCCO4)CC3)C2)c1 |
| InChI | InChI=1S/C21H28N2O4/c1-15-4-2-5-17(12-15)27-18-13-23(14-18)20(24)16-7-9-22(10-8-16)21(25)19-6-3-11-26-19/h2,4-5,12,16,18-19H,3,6-11,13-14H2,1H3/t19-/m0/s1 |
| InChIKey | VALUXLIROFHIBB-IBGZPJMESA-N |
| XLogP | 2.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |