C19H19N5O — CID 124998253
[(2S)-2-[3-(1-methylimidazol-2-yl)pyrazin-2-yl]pyrrolidin-1-yl]-phenylmethanone (PubChem CID 124998253) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is [(2S)-2-[3-(1-methylimidazol-2-yl)pyrazin-2-yl]pyrrolidin-1-yl]-phenylmethanone.
| Compound Name | [(2S)-2-[3-(1-methylimidazol-2-yl)pyrazin-2-yl]pyrrolidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 124998253 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(2S)-2-[3-(1-methylimidazol-2-yl)pyrazin-2-yl]pyrrolidin-1-yl]-phenylmethanone |
| SMILES | Cn1ccnc1-c1nccnc1[C@@H]1CCCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19N5O/c1-23-13-11-22-18(23)17-16(20-9-10-21-17)15-8-5-12-24(15)19(25)14-6-3-2-4-7-14/h2-4,6-7,9-11,13,15H,5,8,12H2,1H3/t15-/m0/s1 |
| InChIKey | RGKYXEGWRBNPDR-HNNXBMFYSA-N |
| XLogP | 2.85 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |