C22H26N6O3 — CID 125001634
3-[[(6R)-2,4-diaminospiro[5H-furo[2,3-d]pyrimidine-6,4'-azepane]-1'-yl]methyl]-5-methyl-1H-indole-2-carboxylic acid (PubChem CID 125001634) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-[[(6R)-2,4-diaminospiro[5H-furo[2,3-d]pyrimidine-6,4'-azepane]-1'-yl]methyl]-5-methyl-1H-indole-2-carboxylic acid.
| Compound Name | 3-[[(6R)-2,4-diaminospiro[5H-furo[2,3-d]pyrimidine-6,4'-azepane]-1'-yl]methyl]-5-methyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 125001634 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 3-[[(6R)-2,4-diaminospiro[5H-furo[2,3-d]pyrimidine-6,4'-azepane]-1'-yl]methyl]-5-methyl-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccc2[nH]c(C(=O)O)c(CN3CCC[C@]4(CC3)Cc3c(N)nc(N)nc3O4)c2c1 |
| InChI | InChI=1S/C22H26N6O3/c1-12-3-4-16-13(9-12)15(17(25-16)20(29)30)11-28-7-2-5-22(6-8-28)10-14-18(23)26-21(24)27-19(14)31-22/h3-4,9,25H,2,5-8,10-11H2,1H3,(H,29,30)(H4,23,24,26,27)/t22-/m0/s1 |
| InChIKey | SESKNQRIMDCZLY-QFIPXVFZSA-N |
| XLogP | 2.49 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|