C28H31FN2O2 — CID 125004099
[4-(3-fluorophenyl)oxan-4-yl]-[(4R)-4-(quinolin-8-ylmethyl)azepan-1-yl]methanone (PubChem CID 125004099) has the molecular formula C28H31FN2O2 and a molecular weight of 446.57 g/mol. Its IUPAC name is [4-(3-fluorophenyl)oxan-4-yl]-[(4R)-4-(quinolin-8-ylmethyl)azepan-1-yl]methanone.
| Compound Name | [4-(3-fluorophenyl)oxan-4-yl]-[(4R)-4-(quinolin-8-ylmethyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 125004099 |
| Molecular Formula | C28H31FN2O2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | [4-(3-fluorophenyl)oxan-4-yl]-[(4R)-4-(quinolin-8-ylmethyl)azepan-1-yl]methanone |
| SMILES | O=C(N1CCC[C@H](Cc2cccc3cccnc23)CC1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C28H31FN2O2/c29-25-10-2-9-24(20-25)28(12-17-33-18-13-28)27(32)31-15-4-5-21(11-16-31)19-23-7-1-6-22-8-3-14-30-26(22)23/h1-3,6-10,14,20-21H,4-5,11-13,15-19H2/t21-/m0/s1 |
| InChIKey | SWHXBYNXAWERFT-NRFANRHFSA-N |
| XLogP | 5.29 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |