C24H26N4O — CID 125006392
6-[(2R)-4-[(E)-2-methyl-3-phenylprop-2-enyl]morpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine (PubChem CID 125006392) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 6-[(2R)-4-[(E)-2-methyl-3-phenylprop-2-enyl]morpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine.
| Compound Name | 6-[(2R)-4-[(E)-2-methyl-3-phenylprop-2-enyl]morpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine |
|---|---|
| PubChem CID | 125006392 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 6-[(2R)-4-[(E)-2-methyl-3-phenylprop-2-enyl]morpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine |
| SMILES | C/C(=C\c1ccccc1)CN1CCO[C@@H](c2ccc(Nc3ccccn3)cn2)C1 |
| InChI | InChI=1S/C24H26N4O/c1-19(15-20-7-3-2-4-8-20)17-28-13-14-29-23(18-28)22-11-10-21(16-26-22)27-24-9-5-6-12-25-24/h2-12,15-16,23H,13-14,17-18H2,1H3,(H,25,27)/b19-15+/t23-/m1/s1 |
| InChIKey | UFWSNTLICXUQGJ-QYAIIROKSA-N |
| XLogP | 4.70 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |